Structure of PDB 5ovr Chain A Binding Site BS01 |
|
|
Ligand ID | AXK |
InChI | InChI=1S/C20H17Cl2O5P/c21-17-9-8-16(11-18(17)22)19(23)15-3-1-2-14(10-15)12-4-6-13(7-5-12)20(24)28(25,26)27/h1-11,19-20,23-24H,(H2,25,26,27)/t19-,20+/m1/s1 |
InChIKey | KYNFSOSPDJUFDE-UXHICEINSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O[CH](c1cccc(c1)c2ccc(cc2)[CH](O)[P](O)(O)=O)c3ccc(Cl)c(Cl)c3 | OpenEye OEToolkits 2.0.6 | c1cc(cc(c1)[C@H](c2ccc(c(c2)Cl)Cl)O)c3ccc(cc3)[C@@H](O)P(=O)(O)O | OpenEye OEToolkits 2.0.6 | c1cc(cc(c1)C(c2ccc(c(c2)Cl)Cl)O)c3ccc(cc3)C(O)P(=O)(O)O | CACTVS 3.385 | O[C@H](c1cccc(c1)c2ccc(cc2)[C@@H](O)[P](O)(O)=O)c3ccc(Cl)c(Cl)c3 |
|
Formula | C20 H17 Cl2 O5 P |
Name | [(~{S})-[4-[3-[(~{R})-(3,4-dichlorophenyl)-oxidanyl-methyl]phenyl]phenyl]-oxidanyl-methyl]phosphonic acid |
ChEMBL | CHEMBL2431664 |
DrugBank | |
ZINC | ZINC000096284978
|
PDB chain | 5ovr Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|