Structure of PDB 5ovh Chain A Binding Site BS01 |
|
|
Ligand ID | AWW |
InChI | InChI=1S/C24H27N3O3S/c1-14(22-9-10-23(31-22)17-8-6-5-7-16(17)13-28)25-24-18-11-20(29-3)21(30-4)12-19(18)26-15(2)27-24/h5-10,14,28H,11-13H2,1-4H3,(H,25,26,27)/t14-/m1/s1 |
InChIKey | JDPGKGHUTNUNTG-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COC1=C(Cc2c(C1)nc(C)nc2N[C@H](C)c3sc(cc3)c4ccccc4CO)OC | OpenEye OEToolkits 2.0.6 | Cc1nc2c(c(n1)NC(C)c3ccc(s3)c4ccccc4CO)CC(=C(C2)OC)OC | OpenEye OEToolkits 2.0.6 | Cc1nc2c(c(n1)N[C@H](C)c3ccc(s3)c4ccccc4CO)CC(=C(C2)OC)OC | CACTVS 3.385 | COC1=C(Cc2c(C1)nc(C)nc2N[CH](C)c3sc(cc3)c4ccccc4CO)OC |
|
Formula | C24 H27 N3 O3 S |
Name | [2-[5-[(1~{R})-1-[(6,7-dimethoxy-2-methyl-5,8-dihydroquinazolin-4-yl)amino]ethyl]thiophen-2-yl]phenyl]methanol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5ovh Chain A Residue 1101
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|