Structure of PDB 5ote Chain A Binding Site BS01 |
|
|
Ligand ID | AQE |
InChI | InChI=1S/C19H23N5S/c1-2-7-23-19(5-1)6-3-10-24(13-19)15-4-8-20-17-16(15)14(12-22-17)18-21-9-11-25-18/h4,8-9,11-12,23H,1-3,5-7,10,13H2,(H,20,22)/t19-/m0/s1 |
InChIKey | AZYKATVQZWSITP-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C1CC[C]2(CCCN(C2)c3ccnc4[nH]cc(c5sccn5)c34)NC1 | OpenEye OEToolkits 2.0.6 | c1cnc2c(c1N3CCCC4(C3)CCCCN4)c(c[nH]2)c5nccs5 | OpenEye OEToolkits 2.0.6 | c1cnc2c(c1N3CCC[C@]4(C3)CCCCN4)c(c[nH]2)c5nccs5 | CACTVS 3.385 | C1CC[C@@]2(CCCN(C2)c3ccnc4[nH]cc(c5sccn5)c34)NC1 |
|
Formula | C19 H23 N5 S |
Name | 2-[4-[(6~{S})-1,8-diazaspiro[5.5]undecan-8-yl]-1~{H}-pyrrolo[2,3-b]pyridin-3-yl]-1,3-thiazole |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5ote Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|