Structure of PDB 5opb Chain A Binding Site BS01 |
|
|
Ligand ID | A1N |
InChI | InChI=1S/C21H25N5O2/c1-13-10-26(11-14(2)27-13)19-9-18(22-12-23-19)20-16-8-15(28-21(3)6-7-21)4-5-17(16)24-25-20/h4-5,8-9,12-14H,6-7,10-11H2,1-3H3,(H,24,25)/t13-,14+ |
InChIKey | ATUUNJCZCOMUKD-OKILXGFUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | C[C@@H]1CN(C[C@@H](O1)C)c2cc(ncn2)c3c4cc(ccc4[nH]n3)OC5(CC5)C | OpenEye OEToolkits 2.0.6 | CC1CN(CC(O1)C)c2cc(ncn2)c3c4cc(ccc4[nH]n3)OC5(CC5)C | CACTVS 3.385 | C[C@H]1CN(C[C@@H](C)O1)c2cc(ncn2)c3n[nH]c4ccc(OC5(C)CC5)cc34 | CACTVS 3.385 | C[CH]1CN(C[CH](C)O1)c2cc(ncn2)c3n[nH]c4ccc(OC5(C)CC5)cc34 |
|
Formula | C21 H25 N5 O2 |
Name | (2~{R},6~{S})-2,6-dimethyl-4-[6-[5-(1-methylcyclopropyl)oxy-1~{H}-indazol-3-yl]pyrimidin-4-yl]morpholine |
ChEMBL | CHEMBL4098877 |
DrugBank | |
ZINC |
|
PDB chain | 5opb Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|