Structure of PDB 5o3a Chain A Binding Site BS01 |
|
|
Ligand ID | 31P |
InChI | InChI=1S/C23H23ClN4O3/c1-5-17(23(29)31-4)21-22-27-26-13(2)28(22)19-11-10-16(30-3)12-18(19)20(25-21)14-6-8-15(24)9-7-14/h6-12,17,21H,5H2,1-4H3/t17-,21+/m1/s1 |
InChIKey | WGMDCNPABCIZCD-UTKZUKDTSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC[C@H]([C@@H]1N=C(c2ccc(Cl)cc2)c3cc(OC)ccc3n4c(C)nnc14)C(=O)OC | OpenEye OEToolkits 1.7.6 | CCC(C1c2nnc(n2-c3ccc(cc3C(=N1)c4ccc(cc4)Cl)OC)C)C(=O)OC | CACTVS 3.385 | CC[CH]([CH]1N=C(c2ccc(Cl)cc2)c3cc(OC)ccc3n4c(C)nnc14)C(=O)OC | ACDLabs 12.01 | O=C(OC)C(CC)C3N=C(c1c(ccc(OC)c1)n2c(nnc23)C)c4ccc(Cl)cc4 | OpenEye OEToolkits 1.7.6 | CC[C@H]([C@H]1c2nnc(n2-c3ccc(cc3C(=N1)c4ccc(cc4)Cl)OC)C)C(=O)OC |
|
Formula | C23 H23 Cl N4 O3 |
Name | methyl (2R)-2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]butanoate |
ChEMBL | CHEMBL3770568 |
DrugBank | |
ZINC | ZINC000117364547
|
PDB chain | 5o3a Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|