Structure of PDB 5nx7 Chain A Binding Site BS01 |
|
|
|
| Ligand ID | 0FV |
| InChI | InChI=1S/C10H19FO7P2/c1-8(2)5-4-6-9(3)10(11)7-17-20(15,16)18-19(12,13)14/h5H,4,6-7H2,1-3H3,(H,15,16)(H2,12,13,14)/b10-9- |
| InChIKey | BYJNSLXDWGDGAC-KTKRTIGZSA-N |
| SMILES | | Software | SMILES |
|---|
| CACTVS 3.370 | CC(C)=CCCC(C)=C(F)CO[P](O)(=O)O[P](O)(O)=O | | ACDLabs 12.01 | O=P(O)(O)OP(=O)(OCC(\F)=C(/C)CC\C=C(/C)C)O | | OpenEye OEToolkits 1.7.6 | CC(=CCC/C(=C(/COP(=O)(O)OP(=O)(O)O)\F)/C)C | | CACTVS 3.370 | CC(C)=CCCC(/C)=C(F)/CO[P](O)(=O)O[P](O)(O)=O | | OpenEye OEToolkits 1.7.6 | CC(=CCCC(=C(COP(=O)(O)OP(=O)(O)O)F)C)C |
|
| Formula | C10 H19 F O7 P2 |
| Name | (2Z)-2-fluoro-3,7-dimethylocta-2,6-dien-1-yl trihydrogen diphosphate;
2-fluorogeranyl diphosphate |
| ChEMBL | |
| DrugBank | |
| ZINC |
|
| PDB chain | 5nx7 Chain A Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|
|
|
|
|
