Structure of PDB 5nm4 Chain A Binding Site BS01 |
|
|
Ligand ID | ZMA |
InChI | InChI=1S/C16H15N7O2/c17-14-20-15(18-8-7-10-3-5-11(24)6-4-10)21-16-19-13(22-23(14)16)12-2-1-9-25-12/h1-6,9,24H,7-8H2,(H3,17,18,19,20,21,22) |
InChIKey | PWTBZOIUWZOPFT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1cc(oc1)c2nc3nc(nc(n3n2)N)NCCc4ccc(cc4)O | ACDLabs 10.04 | n1n3c(nc(nc3nc1c2occc2)NCCc4ccc(O)cc4)N | CACTVS 3.341 | Nc1nc(NCCc2ccc(O)cc2)nc3nc(nn13)c4occc4 |
|
Formula | C16 H15 N7 O2 |
Name | 4-{2-[(7-amino-2-furan-2-yl[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl)amino]ethyl}phenol |
ChEMBL | CHEMBL113142 |
DrugBank | DB08770 |
ZINC | ZINC000000005258
|
PDB chain | 5nm4 Chain A Residue 507
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|