Structure of PDB 5nad Chain A Binding Site BS01 |
|
|
Ligand ID | 8RH |
InChI | InChI=1S/C27H24F5N5O3/c1-14-11-15(3-6-17(14)26(38)35-16-4-5-16)19-13-34-25-18(33-10-9-27(30,31)32)12-22(36-37(19)25)40-21-8-7-20(39-2)23(28)24(21)29/h3,6-8,11-13,16,33H,4-5,9-10H2,1-2H3,(H,35,38) |
InChIKey | WNEILUNVMHVMPH-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | Cc1cc(ccc1C(=O)NC2CC2)c3cnc4n3nc(cc4NCCC(F)(F)F)Oc5ccc(c(c5F)F)OC | CACTVS 3.385 | COc1ccc(Oc2cc(NCCC(F)(F)F)c3ncc(n3n2)c4ccc(c(C)c4)C(=O)NC5CC5)c(F)c1F |
|
Formula | C27 H24 F5 N5 O3 |
Name | BAY 1217389 |
ChEMBL | CHEMBL4456085 |
DrugBank | |
ZINC | ZINC000221039372
|
PDB chain | 5nad Chain A Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|