Structure of PDB 5n84 Chain A Binding Site BS01 |
|
|
Ligand ID | 8Q5 |
InChI | InChI=1S/C20H23N5O/c1-13(2)11-22-18-19-23-12-17(25(19)10-9-21-18)14-3-5-15(6-4-14)20(26)24-16-7-8-16/h3-6,9-10,12-13,16H,7-8,11H2,1-2H3,(H,21,22)(H,24,26) |
InChIKey | QTOFVYOMOKYCEQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC(C)CNc1c2ncc(n2ccn1)c3ccc(cc3)C(=O)NC4CC4 | CACTVS 3.385 | CC(C)CNc1nccn2c(cnc12)c3ccc(cc3)C(=O)NC4CC4 |
|
Formula | C20 H23 N5 O |
Name | ~{N}-cyclopropyl-4-[8-(2-methylpropylamino)imidazo[1,2-a]pyrazin-3-yl]benzamide |
ChEMBL | CHEMBL3410060 |
DrugBank | |
ZINC | ZINC000205323522
|
PDB chain | 5n84 Chain A Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|