Structure of PDB 5n1v Chain A Binding Site BS01 |
|
|
Ligand ID | 8GQ |
InChI | InChI=1S/C25H25N7O4/c26-11-16-12-27-32-22-10-21(29-25(16)32)31-13-19(9-18(31)14-33)35-5-1-2-6-36-20-8-17(28-22)7-15-3-4-23(34)30-24(15)20/h1-2,7-8,10,12,18-19,28,33H,3-6,9,13-14H2,(H,30,34)/b2-1+/t18-,19-/m0/s1 |
InChIKey | SABLEOBBNNRHAD-WNJMFGOSSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC[C@@H]1C[C@H]2C[N@@]1c3cc(Nc4cc5CCC(=O)Nc5c(OC\C=C\CO2)c4)n6ncc(C#N)c6n3 | OpenEye OEToolkits 2.0.6 | c1c2cc(c3c1CCC(=O)N3)OC/C=C/CO[C@H]4C[C@H](N(C4)c5cc(n6c(n5)c(cn6)C#N)N2)CO | CACTVS 3.385 | OC[CH]1C[CH]2C[N]1c3cc(Nc4cc5CCC(=O)Nc5c(OCC=CCO2)c4)n6ncc(C#N)c6n3 | OpenEye OEToolkits 2.0.6 | c1c2cc(c3c1CCC(=O)N3)OCC=CCOC4CC(N(C4)c5cc(n6c(n5)c(cn6)C#N)N2)CO |
|
Formula | C25 H25 N7 O4 |
Name | pyrazolo-pyrimidine macrocycle |
ChEMBL | CHEMBL4094351 |
DrugBank | |
ZINC |
|
PDB chain | 5n1v Chain A Residue 413
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|