Structure of PDB 5mt0 Chain A Binding Site BS01 |
|
|
Ligand ID | QJS |
InChI | InChI=1S/C19H15FN2O3/c20-11-6-7-15-14(8-11)16(17(21-15)19(24)25)22-18(23)13-9-12(13)10-4-2-1-3-5-10/h1-8,12-13,21H,9H2,(H,22,23)(H,24,25)/t12-,13+/m1/s1 |
InChIKey | LBCNHUJFDVBZDB-OLZOCXBDSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)c1[nH]c2ccc(F)cc2c1NC(=O)[CH]3C[CH]3c4ccccc4 | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)[C@H]2C[C@@H]2C(=O)Nc3c4cc(ccc4[nH]c3C(=O)O)F | CACTVS 3.385 | OC(=O)c1[nH]c2ccc(F)cc2c1NC(=O)[C@H]3C[C@@H]3c4ccccc4 | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)C2CC2C(=O)Nc3c4cc(ccc4[nH]c3C(=O)O)F |
|
Formula | C19 H15 F N2 O3 |
Name | 5-fluoranyl-3-[[(1~{S},2~{S})-2-phenylcyclopropyl]carbonylamino]-1~{H}-indole-2-carboxylic acid |
ChEMBL | CHEMBL4085766 |
DrugBank | |
ZINC | ZINC000016035064
|
PDB chain | 5mt0 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|