Structure of PDB 5mrd Chain A Binding Site BS01 |
|
|
Ligand ID | S26 |
InChI | InChI=1S/C18H13ClN2O4S2/c1-2-25-17(24)13-14(11-4-3-7-26-11)21(16(23)15(13)22)18-20-10-6-5-9(19)8-12(10)27-18/h3-8,14,22H,2H2,1H3/t14-/m1/s1 |
InChIKey | PKERYICWLBJVFG-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCOC(=O)C1=C(O)C(=O)N([C@@H]1c2sccc2)c3sc4cc(Cl)ccc4n3 | OpenEye OEToolkits 2.0.6 | CCOC(=O)C1=C(C(=O)N(C1c2cccs2)c3nc4ccc(cc4s3)Cl)O | OpenEye OEToolkits 2.0.6 | CCOC(=O)C1=C(C(=O)N([C@@H]1c2cccs2)c3nc4ccc(cc4s3)Cl)O | CACTVS 3.385 | CCOC(=O)C1=C(O)C(=O)N([CH]1c2sccc2)c3sc4cc(Cl)ccc4n3 |
|
Formula | C18 H13 Cl N2 O4 S2 |
Name | ethyl (2~{S})-1-(6-chloranyl-1,3-benzothiazol-2-yl)-4-oxidanyl-5-oxidanylidene-2-thiophen-2-yl-2~{H}-pyrrole-3-carboxylate; PS267 |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905673
|
PDB chain | 5mrd Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|