Structure of PDB 5mah Chain A Binding Site BS01 |
|
|
Ligand ID | 7KD |
InChI | InChI=1S/C20H21F3N8O3S/c1-24-18(32)12-4-6-13(7-5-12)29-19-28-10-14(20(21,22)23)16(30-19)27-11-15-17(26-9-8-25-15)31(2)35(3,33)34/h4-10H,11H2,1-3H3,(H,24,32)(H2,27,28,29,30) |
InChIKey | FWLMVFUGMHIOAA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CNC(=O)c1ccc(Nc2ncc(c(NCc3nccnc3N(C)[S](C)(=O)=O)n2)C(F)(F)F)cc1 | OpenEye OEToolkits 2.0.6 | CNC(=O)c1ccc(cc1)Nc2ncc(c(n2)NCc3c(nccn3)N(C)S(=O)(=O)C)C(F)(F)F |
|
Formula | C20 H21 F3 N8 O3 S |
Name | ~{N}-methyl-4-[[4-[[3-[methyl(methylsulfonyl)amino]pyrazin-2-yl]methylamino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide |
ChEMBL | CHEMBL3137331 |
DrugBank | DB12282 |
ZINC | ZINC000103297739
|
PDB chain | 5mah Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|