Structure of PDB 5m4b Chain A Binding Site BS01 |
|
|
Ligand ID | 7F7 |
InChI | InChI=1S/C14H20N3O6P/c1-9-13(18)11(10(6-16-9)8-23-24(20,21)22)7-17-12-4-2-3-5-15-14(12)19/h6-7,12,18H,2-5,8H2,1H3,(H,15,19)(H2,20,21,22)/b17-7+/t12-/m1/s1 |
InChIKey | QOFJUFQRGNVZPX-KOSUEXCASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(C=N[CH]2CCCCNC2=O)c1O | OpenEye OEToolkits 2.0.6 | Cc1c(c(c(cn1)COP(=O)(O)O)C=NC2CCCCNC2=O)O | OpenEye OEToolkits 2.0.6 | Cc1c(c(c(cn1)COP(=O)(O)O)/C=N/[C@@H]2CCCCNC2=O)O | CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(C=N[C@@H]2CCCCNC2=O)c1O |
|
Formula | C14 H20 N3 O6 P |
Name | [6-methyl-5-oxidanyl-4-[(~{E})-[(3~{R})-2-oxidanylideneazepan-3-yl]iminomethyl]pyridin-3-yl]methyl dihydrogen phosphate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5m4b Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|