Structure of PDB 5m2v Chain A Binding Site BS01 |
|
|
Ligand ID | 7E5 |
InChI | InChI=1S/C12H13NO5/c14-11(15)8-3-1-2-4-10(8)18-7-5-9(12(16)17)13-6-7/h1-4,7,9,13H,5-6H2,(H,14,15)(H,16,17)/t7-,9+/m1/s1 |
InChIKey | XHABYXGKUZQAIW-APPZFPTMSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1ccc(c(c1)C(=O)O)OC2CC(NC2)C(=O)O | CACTVS 3.385 | OC(=O)[C@@H]1C[C@H](CN1)Oc2ccccc2C(O)=O | CACTVS 3.385 | OC(=O)[CH]1C[CH](CN1)Oc2ccccc2C(O)=O | OpenEye OEToolkits 2.0.6 | c1ccc(c(c1)C(=O)O)O[C@@H]2C[C@H](NC2)C(=O)O |
|
Formula | C12 H13 N O5 |
Name | (2~{S},4~{R})-4-(2-carboxyphenoxy)pyrrolidine-2-carboxylic acid |
ChEMBL | CHEMBL4117901 |
DrugBank | |
ZINC | ZINC000223803105
|
PDB chain | 5m2v Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|