Structure of PDB 5lz9 Chain A Binding Site BS01 |
|
|
Ligand ID | 7BR |
InChI | InChI=1S/C19H23FN2O4S/c1-19(4-8-27(24,25)9-5-19)15-11-18(23)22(13-15)6-7-26-16-2-3-17(20)14(10-16)12-21/h2-3,10,15H,4-9,11,13H2,1H3/t15-/m1/s1 |
InChIKey | SYEMWCXBADSSGE-OAHLLOKOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC1(CCS(=O)(=O)CC1)[C@@H]2CC(=O)N(C2)CCOc3ccc(c(c3)C#N)F | CACTVS 3.385 | CC1(CC[S](=O)(=O)CC1)[C@H]2CN(CCOc3ccc(F)c(c3)C#N)C(=O)C2 | CACTVS 3.385 | CC1(CC[S](=O)(=O)CC1)[CH]2CN(CCOc3ccc(F)c(c3)C#N)C(=O)C2 | OpenEye OEToolkits 2.0.6 | CC1(CCS(=O)(=O)CC1)C2CC(=O)N(C2)CCOc3ccc(c(c3)C#N)F |
|
Formula | C19 H23 F N2 O4 S |
Name | 2-fluoranyl-5-[2-[(4~{S})-4-[4-methyl-1,1-bis(oxidanylidene)thian-4-yl]-2-oxidanylidene-pyrrolidin-1-yl]ethoxy]benzenecarbonitrile |
ChEMBL | CHEMBL3922315 |
DrugBank | |
ZINC | ZINC000584905440
|
PDB chain | 5lz9 Chain A Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.1.47: 1-alkyl-2-acetylglycerophosphocholine esterase. |
|
|
|