Structure of PDB 5lwo Chain A Binding Site BS01 |
|
|
Ligand ID | RXR |
InChI | InChI=1S/C10H19NOS2/c1-9(2)7(5-13)8(6-14)10(3,4)11(9)12/h12-14H,5-6H2,1-4H3 |
InChIKey | PZEXYXPQVHSRCF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CC1(C(=C(C(N1[O])(C)C)CS)CS)C | CACTVS 3.370 | CC1(C)N([O])C(C)(C)C(=C1CS)CS | ACDLabs 12.01 | ON1C(C(=C(CS)C1(C)C)CS)(C)C |
|
Formula | C10 H18 N O S2 |
Name | [2,2,5,5-tetramethyl-3,4-bis(sulfanylmethyl)-2,5-dihydro-1H-pyrrol-1-yl]oxidanyl radical; 3,4-bis(thiomethyl)-2,2,5,5-tetramethyl-1H-Pyrrol-1-yloxyl radical |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5lwo Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E11 D20 |
Catalytic site (residue number reindexed from 1) |
E11 D20 |
Enzyme Commision number |
3.2.1.17: lysozyme. |
|
|
|