Structure of PDB 5luu Chain A Binding Site BS01 |
|
|
Ligand ID | 77X |
InChI | InChI=1S/C15H17N3O/c1-2-14(19)18-9-8-13-12(10-18)15(17-16-13)11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3,(H,16,17) |
InChIKey | DVIQMCGALYMKFG-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.5 | CCC(=O)N1CCc2c(c(n[nH]2)c3ccccc3)C1 | CACTVS 3.385 | CCC(=O)N1CCc2[nH]nc(c2C1)c3ccccc3 |
|
Formula | C15 H17 N3 O |
Name | 1-(3-phenyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl)propan-1-one |
ChEMBL | CHEMBL3959972 |
DrugBank | |
ZINC | ZINC000008743818
|
PDB chain | 5luu Chain A Residue 203
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|