Structure of PDB 5l97 Chain A Binding Site BS01 |
|
|
Ligand ID | 6RW |
InChI | InChI=1S/C12H18N2O2S/c1-9-10(6-4-8-13-9)14-11-5-3-7-12(11)17(2,15)16/h4,6,8,11-12,14H,3,5,7H2,1-2H3/t11-,12+/m1/s1 |
InChIKey | BFFKQDIRHHTNOE-NEPJUHHUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.5 | Cc1c(cccn1)NC2CCCC2S(=O)(=O)C | OpenEye OEToolkits 2.0.5 | Cc1c(cccn1)NC2CCC[C@@H]2S(=O)(=O)C | CACTVS 3.385 | Cc1ncccc1N[C@@H]2CCC[C@@H]2[S](C)(=O)=O | CACTVS 3.385 | Cc1ncccc1N[CH]2CCC[CH]2[S](C)(=O)=O |
|
Formula | C12 H18 N2 O2 S |
Name | 2-methyl-~{N}-[(2~{S})-2-methylsulfonylcyclopentyl]pyridin-3-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000091495797
|
PDB chain | 5l97 Chain A Residue 2001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|