Structure of PDB 5kyj Chain A Binding Site BS01 |
|
|
Ligand ID | 6Y8 |
InChI | InChI=1S/C20H22FN5O3S/c1-12(2)18-17-13(10-25(18)19-16(21)9-22-20(23-19)29-3)11-26(24-17)14-6-5-7-15(8-14)30(4,27)28/h5-9,11-12,18H,10H2,1-4H3/t18-/m1/s1 |
InChIKey | HDDKTNCZLILPNB-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ncc(F)c(n1)N2Cc3cn(nc3[CH]2C(C)C)c4cccc(c4)[S](C)(=O)=O | CACTVS 3.385 | COc1ncc(F)c(n1)N2Cc3cn(nc3[C@H]2C(C)C)c4cccc(c4)[S](C)(=O)=O | OpenEye OEToolkits 2.0.5 | CC(C)C1c2c(cn(n2)c3cccc(c3)S(=O)(=O)C)CN1c4c(cnc(n4)OC)F | OpenEye OEToolkits 2.0.5 | CC(C)[C@@H]1c2c(cn(n2)c3cccc(c3)S(=O)(=O)C)CN1c4c(cnc(n4)OC)F |
|
Formula | C20 H22 F N5 O3 S |
Name | (6~{R})-5-(5-fluoranyl-2-methoxy-pyrimidin-4-yl)-2-(3-methylsulfonylphenyl)-6-propan-2-yl-4,6-dihydropyrrolo[3,4-c]pyrazole |
ChEMBL | CHEMBL3972392 |
DrugBank | |
ZINC | ZINC000584905019
|
PDB chain | 5kyj Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|