Structure of PDB 5ktx Chain A Binding Site BS01 |
|
|
Ligand ID | 6XH |
InChI | InChI=1S/C22H25FN6O2/c1-14(30)28-7-5-21-18(12-28)22(26-29(21)17-6-8-31-13-17)25-20-4-3-15(9-19(20)23)16-10-24-27(2)11-16/h3-4,9-11,17H,5-8,12-13H2,1-2H3,(H,25,26)/t17-/m0/s1 |
InChIKey | NKOJNOBJGYTLLZ-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cn1cc(cn1)c2ccc(Nc3nn([CH]4CCOC4)c5CCN(Cc35)C(C)=O)c(F)c2 | OpenEye OEToolkits 2.0.5 | CC(=O)N1CCc2c(c(nn2C3CCOC3)Nc4ccc(cc4F)c5cnn(c5)C)C1 | OpenEye OEToolkits 2.0.5 | CC(=O)N1CCc2c(c(nn2[C@H]3CCOC3)Nc4ccc(cc4F)c5cnn(c5)C)C1 | CACTVS 3.385 | Cn1cc(cn1)c2ccc(Nc3nn([C@H]4CCOC4)c5CCN(Cc35)C(C)=O)c(F)c2 |
|
Formula | C22 H25 F N6 O2 |
Name | 1-[3-[[2-fluoranyl-4-(1-methylpyrazol-4-yl)phenyl]amino]-1-[(3~{S})-oxolan-3-yl]-6,7-dihydro-4~{H}-pyrazolo[4,3-c]pyridin-5-yl]ethanone |
ChEMBL | CHEMBL3897393 |
DrugBank | |
ZINC |
|
PDB chain | 5ktx Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|