Structure of PDB 5knt Chain A Binding Site BS01 |
|
|
Ligand ID | 6WB |
InChI | InChI=1S/C12H20N5O6P/c18-6-9(19)5-16(3-4-24(21,22)23)1-2-17-8-15-10-11(17)13-7-14-12(10)20/h7-9,18-19H,1-6H2,(H,13,14,20)(H2,21,22,23)/t9-/m0/s1 |
InChIKey | XBILBXZMSMIUBY-VIFPVBQESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.5 | c1nc2c(n1CCN(CCP(=O)(O)O)C[C@@H](CO)O)N=CNC2=O | OpenEye OEToolkits 2.0.5 | c1nc2c(n1CCN(CCP(=O)(O)O)CC(CO)O)N=CNC2=O | CACTVS 3.385 | OC[CH](O)CN(CCn1cnc2C(=O)NC=Nc12)CC[P](O)(O)=O | CACTVS 3.385 | OC[C@@H](O)CN(CCn1cnc2C(=O)NC=Nc12)CC[P](O)(O)=O |
|
Formula | C12 H20 N5 O6 P |
Name | 2-[[(2~{S})-2,3-bis(oxidanyl)propyl]-[2-(6-oxidanylidene-1~{H}-purin-9-yl)ethyl]amino]ethylphosphonic acid; 2-((2,3-Dihydroxypropyl)(2-(hypoxanthin-9-yl)ethyl)amino)ethylphosphonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000473110893
|
PDB chain | 5knt Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|