Structure of PDB 5khi Chain A Binding Site BS01 |
|
|
Ligand ID | 6SX |
InChI | InChI=1S/C10H11N4O6P/c15-7-8-6(2-18-21(16,17)20-8)19-10(7)14-4-13-5-1-11-3-12-9(5)14/h1,3-4,6-8,10,15H,2H2,(H,16,17)/t6-,7-,8-,10-/m1/s1 |
InChIKey | AVSJXTVPIHQRPY-FDDDBJFASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.5 | c1c2c(ncn1)n(cn2)[C@H]3[C@@H]([C@H]4[C@H](O3)COP(=O)(O4)O)O | OpenEye OEToolkits 2.0.5 | c1c2c(ncn1)n(cn2)C3C(C4C(O3)COP(=O)(O4)O)O | CACTVS 3.385 | O[CH]1[CH]2O[P](O)(=O)OC[CH]2O[CH]1n3cnc4cncnc34 | CACTVS 3.385 | O[C@@H]1[C@@H]2O[P](O)(=O)OC[C@H]2O[C@H]1n3cnc4cncnc34 |
|
Formula | C10 H11 N4 O6 P |
Name | Purine riboside-3',5'-cyclic monophosphate; cPuMP |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5khi Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|