Structure of PDB 5k5n Chain A Binding Site BS01 |
|
|
Ligand ID | 6QH |
InChI | InChI=1S/C16H16ClN5O3/c1-24-13-4-3-11(7-12(13)17)15-14(20-10-25-15)16(23)19-5-2-6-22-9-18-8-21-22/h3-4,7-10H,2,5-6H2,1H3,(H,19,23) |
InChIKey | RQFYFNAGNBUGFC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ccc(cc1Cl)c2ocnc2C(=O)NCCCn3cncn3 | OpenEye OEToolkits 2.0.5 | COc1ccc(cc1Cl)c2c(nco2)C(=O)NCCCn3cncn3 |
|
Formula | C16 H16 Cl N5 O3 |
Name | 5-(3-chloranyl-4-methoxy-phenyl)-~{N}-[3-(1,2,4-triazol-1-yl)propyl]-1,3-oxazole-4-carboxamide |
ChEMBL | CHEMBL5173945 |
DrugBank | |
ZINC | ZINC000203389509
|
PDB chain | 5k5n Chain A Residue 4001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|