Structure of PDB 5jnl Chain A Binding Site BS01 |
|
|
Ligand ID | L54 |
InChI | InChI=1S/C15H21F3NO5P/c1-19(21)14(20)9-12(10-25(22,23)24)4-2-3-11-5-7-13(8-6-11)15(16,17)18/h5-8,12,21H,2-4,9-10H2,1H3,(H2,22,23,24)/t12-/m1/s1 |
InChIKey | QJHOMBPUEUGKSC-GFCCVEGCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | CN(C(=O)CC(CCCc1ccc(cc1)C(F)(F)F)CP(=O)(O)O)O | CACTVS 3.385 | CN(O)C(=O)C[CH](CCCc1ccc(cc1)C(F)(F)F)C[P](O)(O)=O | OpenEye OEToolkits 2.0.4 | CN(C(=O)C[C@@H](CCCc1ccc(cc1)C(F)(F)F)CP(=O)(O)O)O | CACTVS 3.385 | CN(O)C(=O)C[C@@H](CCCc1ccc(cc1)C(F)(F)F)C[P](O)(O)=O | ACDLabs 12.01 | O=C(CC(CP(O)(O)=O)CCCc1ccc(cc1)C(F)(F)F)N(O)C |
|
Formula | C15 H21 F3 N O5 P |
Name | {(2R)-2-{2-[hydroxy(methyl)amino]-2-oxoethyl}-5-[4-(trifluoromethyl)phenyl]pentyl}phosphonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905594
|
PDB chain | 5jnl Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.267: 1-deoxy-D-xylulose-5-phosphate reductoisomerase. |
|
|
|