Structure of PDB 5jms Chain A Binding Site BS01 |
|
|
Ligand ID | 6LP |
InChI | InChI=1S/C17H17ClN6/c18-13-2-1-3-14(11-13)23-17-22-8-5-15(24-17)12-4-7-20-16(10-12)21-9-6-19/h1-5,7-8,10-11H,6,9,19H2,(H,20,21)(H,22,23,24) |
InChIKey | OGZKVNUWPYUXNL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c1(nc(ncc1)Nc2cc(ccc2)Cl)c3cc(ncc3)NCCN | OpenEye OEToolkits 2.0.4 | c1cc(cc(c1)Cl)Nc2nccc(n2)c3ccnc(c3)NCCN | CACTVS 3.385 | NCCNc1cc(ccn1)c2ccnc(Nc3cccc(Cl)c3)n2 |
|
Formula | C17 H17 Cl N6 |
Name | N~1~-(4-{2-[(3-chlorophenyl)amino]pyrimidin-4-yl}pyridin-2-yl)ethane-1,2-diamine |
ChEMBL | CHEMBL584384 |
DrugBank | |
ZINC | ZINC000001541870
|
PDB chain | 5jms Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|