Structure of PDB 5jfx Chain A Binding Site BS01 |
|
|
Ligand ID | 6K4 |
InChI | InChI=1S/C23H22ClN7O3/c1-23(2,12-32)31-11-18(17-10-28-22(25)30-21(17)31)20(34)13-5-16(9-26-7-13)29-19(33)6-15-4-3-14(24)8-27-15/h3-5,7-11,32H,6,12H2,1-2H3,(H,29,33)(H2,25,28,30) |
InChIKey | BPIWZDNVMQQBQX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | C(O)C(C)(C)n2cc(c1cnc(N)nc12)C(=O)c4cc(NC(Cc3ncc(cc3)Cl)=O)cnc4 | OpenEye OEToolkits 2.0.4 | CC(C)(CO)n1cc(c2c1nc(nc2)N)C(=O)c3cc(cnc3)NC(=O)Cc4ccc(cn4)Cl | CACTVS 3.385 | CC(C)(CO)n1cc(C(=O)c2cncc(NC(=O)Cc3ccc(Cl)cn3)c2)c4cnc(N)nc14 |
|
Formula | C23 H22 Cl N7 O3 |
Name | N-{5-[2-amino-7-(1-hydroxy-2-methylpropan-2-yl)-7H-pyrrolo[2,3-d]pyrimidine-5-carbonyl]pyridin-3-yl}-2-(5-chloropyridin-2-yl)acetamide |
ChEMBL | CHEMBL4212531 |
DrugBank | DB12269 |
ZINC | ZINC000203540977
|
PDB chain | 5jfx Chain A Residue 4000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|