Structure of PDB 5jf5 Chain A Binding Site BS01 |
|
|
Ligand ID | 7JT |
InChI | InChI=1S/C19H23N3O5/c23-18(21-24)10-14(7-12-3-1-2-4-12)19-20-17(22-27-19)9-13-5-6-15-16(8-13)26-11-25-15/h5-6,8,12,14,24H,1-4,7,9-11H2,(H,21,23)/t14-/m1/s1 |
InChIKey | XOZSWEYBEQSKBV-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | c1cc2c(cc1Cc3nc(on3)[C@H](CC4CCCC4)CC(=O)NO)OCO2 | ACDLabs 12.01 | N(C(CC(c1onc(n1)Cc2cc3c(cc2)OCO3)CC4CCCC4)=O)O | OpenEye OEToolkits 2.0.4 | c1cc2c(cc1Cc3nc(on3)C(CC4CCCC4)CC(=O)NO)OCO2 | CACTVS 3.385 | ONC(=O)C[CH](CC1CCCC1)c2onc(Cc3ccc4OCOc4c3)n2 | CACTVS 3.385 | ONC(=O)C[C@@H](CC1CCCC1)c2onc(Cc3ccc4OCOc4c3)n2 |
|
Formula | C19 H23 N3 O5 |
Name | (3R)-3-{3-[(2H-1,3-benzodioxol-5-yl)methyl]-1,2,4-oxadiazol-5-yl}-4-cyclopentyl-N-hydroxybutanamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905469
|
PDB chain | 5jf5 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|