Structure of PDB 5jf3 Chain A Binding Site BS01 |
|
|
Ligand ID | SF5 |
InChI | InChI=1S/C18H23N3O5/c1-3-4-5-14(11-16(22)20-24)17-19-15(21-26-17)10-12-6-8-13(9-7-12)18(23)25-2/h6-9,14,24H,3-5,10-11H2,1-2H3,(H,20,22)/t14-/m1/s1 |
InChIKey | PKBQPXFVXNPVJM-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | CCCC[C@H](CC(=O)NO)c1nc(no1)Cc2ccc(cc2)C(=O)OC | CACTVS 3.385 | CCCC[C@H](CC(=O)NO)c1onc(Cc2ccc(cc2)C(=O)OC)n1 | CACTVS 3.385 | CCCC[CH](CC(=O)NO)c1onc(Cc2ccc(cc2)C(=O)OC)n1 | OpenEye OEToolkits 2.0.4 | CCCCC(CC(=O)NO)c1nc(no1)Cc2ccc(cc2)C(=O)OC | ACDLabs 12.01 | N(C(CC(c1onc(n1)Cc2ccc(cc2)C(=O)OC)CCCC)=O)O |
|
Formula | C18 H23 N3 O5 |
Name | methyl 4-({5-[(3R)-1-(hydroxyamino)-1-oxoheptan-3-yl]-1,2,4-oxadiazol-3-yl}methyl)benzoate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905672
|
PDB chain | 5jf3 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|