Structure of PDB 5jf2 Chain A Binding Site BS01 |
|
|
Ligand ID | SF7 |
InChI | InChI=1S/C16H20FN3O3/c1-2-3-4-12(10-15(21)19-22)16-18-14(20-23-16)9-11-5-7-13(17)8-6-11/h5-8,12,22H,2-4,9-10H2,1H3,(H,19,21)/t12-/m1/s1 |
InChIKey | NPHICFLHFQUZKX-GFCCVEGCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | CCCC[C@H](CC(=O)NO)c1nc(no1)Cc2ccc(cc2)F | CACTVS 3.385 | CCCC[C@H](CC(=O)NO)c1onc(Cc2ccc(F)cc2)n1 | OpenEye OEToolkits 2.0.4 | CCCCC(CC(=O)NO)c1nc(no1)Cc2ccc(cc2)F | ACDLabs 12.01 | O=C(CC(c1nc(no1)Cc2ccc(cc2)F)CCCC)NO | CACTVS 3.385 | CCCC[CH](CC(=O)NO)c1onc(Cc2ccc(F)cc2)n1 |
|
Formula | C16 H20 F N3 O3 |
Name | (3R)-3-{3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl}-N-hydroxyheptanamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000203341391
|
PDB chain | 5jf2 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|