Structure of PDB 5jaz Chain A Binding Site BS01 |
|
|
Ligand ID | LC5 |
InChI | InChI=1S/C18H24NO5P/c1-19(21)18(20)12-14(13-25(22,23)24)6-4-8-16-10-5-9-15-7-2-3-11-17(15)16/h2-3,5,7,9-11,14,21H,4,6,8,12-13H2,1H3,(H2,22,23,24)/t14-/m1/s1 |
InChIKey | HUBGFLNAUJJVOG-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(CC(CP(O)(O)=O)CCCc2c1ccccc1ccc2)N(O)C | OpenEye OEToolkits 2.0.4 | CN(C(=O)C[C@@H](CCCc1cccc2c1cccc2)CP(=O)(O)O)O | CACTVS 3.385 | CN(O)C(=O)C[C@@H](CCCc1cccc2ccccc12)C[P](O)(O)=O | CACTVS 3.385 | CN(O)C(=O)C[CH](CCCc1cccc2ccccc12)C[P](O)(O)=O | OpenEye OEToolkits 2.0.4 | CN(C(=O)CC(CCCc1cccc2c1cccc2)CP(=O)(O)O)O |
|
Formula | C18 H24 N O5 P |
Name | [(2R)-2-{2-[hydroxy(methyl)amino]-2-oxoethyl}-5-(naphthalen-1-yl)pentyl]phosphonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905590
|
PDB chain | 5jaz Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.267: 1-deoxy-D-xylulose-5-phosphate reductoisomerase. |
|
|
|