Structure of PDB 5j9z Chain A Binding Site BS01 |
|
|
Ligand ID | 6HJ |
InChI | InChI=1S/C22H23N7O/c1-3-18(30)28-10-6-7-14(11-28)29-22-19(21(23)24-13-25-22)20(26-29)16-12-27(2)17-9-5-4-8-15(16)17/h3-5,8-9,12-14H,1,6-7,10-11H2,2H3,(H2,23,24,25)/t14-/m1/s1 |
InChIKey | KFYRXHYWURCCBT-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | Cn1cc(c2c1cccc2)c3c4c(ncnc4n(n3)C5CCCN(C5)C(=O)C=C)N | OpenEye OEToolkits 2.0.4 | Cn1cc(c2c1cccc2)c3c4c(ncnc4n(n3)[C@@H]5CCCN(C5)C(=O)C=C)N | CACTVS 3.385 | Cn1cc(c2ccccc12)c3nn([CH]4CCCN(C4)C(=O)C=C)c5ncnc(N)c35 | CACTVS 3.385 | Cn1cc(c2ccccc12)c3nn([C@@H]4CCCN(C4)C(=O)C=C)c5ncnc(N)c35 | ACDLabs 12.01 | c12ncnc(c1c(nn2C3CN(C(/C=C)=O)CCC3)c5c4ccccc4n(c5)C)N |
|
Formula | C22 H23 N7 O |
Name | (R)-1-(3-(4-amino-3-(1-methyl-1H-indol-3-yl)-1H-pyrazolo[3,4-d]pyrimidin-1-yl)piperidin-1-yl)prop-2-en-1-one |
ChEMBL | CHEMBL4094959 |
DrugBank | |
ZINC | ZINC000584904734
|
PDB chain | 5j9z Chain A Residue 1101
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|