Structure of PDB 5j9y Chain A Binding Site BS01 |
|
|
Ligand ID | 6HL |
InChI | InChI=1S/C23H22N6O/c1-2-19(30)28-12-6-9-16(13-28)29-23-20(22(24)25-14-26-23)21(27-29)18-11-5-8-15-7-3-4-10-17(15)18/h2-5,7-8,10-11,14,16H,1,6,9,12-13H2,(H2,24,25,26)/t16-/m1/s1 |
InChIKey | WAJKANXMXJLTKT-MRXNPFEDSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Nc1ncnc2n(nc(c3cccc4ccccc34)c12)[CH]5CCCN(C5)C(=O)C=C | CACTVS 3.385 | Nc1ncnc2n(nc(c3cccc4ccccc34)c12)[C@@H]5CCCN(C5)C(=O)C=C | OpenEye OEToolkits 2.0.4 | C=CC(=O)N1CCC[C@H](C1)n2c3c(c(n2)c4cccc5c4cccc5)c(ncn3)N | ACDLabs 12.01 | c12ncnc(c1c(nn2C3CN(C([C@H]=C)=O)CCC3)c5c4ccccc4ccc5)N | OpenEye OEToolkits 2.0.4 | C=CC(=O)N1CCCC(C1)n2c3c(c(n2)c4cccc5c4cccc5)c(ncn3)N |
|
Formula | C23 H22 N6 O |
Name | (R)-1-(3-(4-amino-3-(naphthalen-1-yl)-1H-pyrazolo[3,4-d]pyrimidin-1-yl)piperidin-1-yl)prop-2-en-1-one |
ChEMBL | CHEMBL4095447 |
DrugBank | |
ZINC | ZINC000584904896
|
PDB chain | 5j9y Chain A Residue 1101
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|