Structure of PDB 5j8x Chain A Binding Site BS01 |
|
|
Ligand ID | OK3 |
InChI | InChI=1S/C17H18BN2O6/c19-9-10-4-6-11(7-5-10)16(21)20-14-8-12-2-1-3-13(17(22)23)15(12)26-18(14,24)25/h1-7,14,24-25H,8-9,19H2,(H,20,21)(H,22,23)/q-1/t14-/m0/s1 |
InChIKey | QLXKUYDHLJOWQG-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NCc1ccc(cc1)C(=O)N[C@H]2Cc3cccc(C(O)=O)c3O[B-]2(O)O | OpenEye OEToolkits 2.0.7 | [B-]1(C(Cc2cccc(c2O1)C(=O)O)NC(=O)c3ccc(cc3)CN)(O)O | OpenEye OEToolkits 2.0.7 | [B-]1([C@H](Cc2cccc(c2O1)C(=O)O)NC(=O)c3ccc(cc3)CN)(O)O | CACTVS 3.385 | NCc1ccc(cc1)C(=O)N[CH]2Cc3cccc(C(O)=O)c3O[B-]2(O)O |
|
Formula | C17 H18 B N2 O6 |
Name | (4~{R})-4-[[4-(aminomethyl)phenyl]carbonylamino]-3,3-bis(oxidanyl)-2-oxa-3-boranuidabicyclo[4.4.0]deca-1(10),6,8-triene-10-carboxylic acid |
ChEMBL | CHEMBL4461260 |
DrugBank | |
ZINC |
|
PDB chain | 5j8x Chain A Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|