Structure of PDB 5j5t Chain A Binding Site BS01 |
|
|
Ligand ID | 6G2 |
InChI | InChI=1S/C19H21N5OS/c20-18-16(25-12-13-1-5-21-6-2-13)9-15(10-23-18)17-11-24-19(26-17)14-3-7-22-8-4-14/h1-2,5-6,9-11,14,22H,3-4,7-8,12H2,(H2,20,23) |
InChIKey | HSEGDFMLRPWOHH-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Nc1ncc(cc1OCc2ccncc2)c3sc(nc3)C4CCNCC4 | OpenEye OEToolkits 2.0.4 | c1cnccc1COc2cc(cnc2N)c3cnc(s3)C4CCNCC4 | ACDLabs 12.01 | c1(ncc(cc1OCc2ccncc2)c3sc(nc3)C4CCNCC4)N |
|
Formula | C19 H21 N5 O S |
Name | 5-[2-(piperidin-4-yl)-1,3-thiazol-5-yl]-3-[(pyridin-4-yl)methoxy]pyridin-2-amine |
ChEMBL | CHEMBL4749141 |
DrugBank | |
ZINC | ZINC000584904715
|
PDB chain | 5j5t Chain A Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|