Structure of PDB 5ivf Chain A Binding Site BS01 |
|
|
Ligand ID | 6EB |
InChI | InChI=1S/C15H14F3N5O2/c1-23-7-10(20-8-23)12-11-9(3-5-19-12)13(24)22-14(21-11)25-6-2-4-15(16,17)18/h3,5,7-8H,2,4,6H2,1H3,(H,21,22,24) |
InChIKey | GVIVKUKLHYWHES-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cn1cnc(c1)c2nccc3c(O)nc(OCCCC(F)(F)F)nc23 | ACDLabs 12.01 | c3(OCCCC(F)(F)F)nc(O)c2c(c(c1ncn(C)c1)ncc2)n3 | OpenEye OEToolkits 2.0.4 | Cn1cc(nc1)c2c3c(ccn2)c(nc(n3)OCCCC(F)(F)F)O |
|
Formula | C15 H14 F3 N5 O2 |
Name | 8-(1-methyl-1H-imidazol-4-yl)-2-(4,4,4-trifluorobutoxy)pyrido[3,4-d]pyrimidin-4-ol |
ChEMBL | CHEMBL3787534 |
DrugBank | |
ZINC | ZINC000584904707
|
PDB chain | 5ivf Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|