Structure of PDB 5ivc Chain A Binding Site BS01 |
|
|
Ligand ID | 6E7 |
InChI | InChI=1S/C20H17N3O3/c24-19(23-9-6-14-4-2-1-3-5-14)15-7-10-21-17(12-15)18-13-16(20(25)26)8-11-22-18/h1-5,7-8,10-13H,6,9H2,(H,23,24)(H,25,26) |
InChIKey | DSGOLESVOJUGOK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | c1ccc(cc1)CCNC(=O)c2ccnc(c2)c3cc(ccn3)C(=O)O | CACTVS 3.385 | OC(=O)c1ccnc(c1)c2cc(ccn2)C(=O)NCCc3ccccc3 | ACDLabs 12.01 | c1(cc(ccn1)C(NCCc2ccccc2)=O)c3nccc(C(=O)O)c3 |
|
Formula | C20 H17 N3 O3 |
Name | 4'-[(2-phenylethyl)carbamoyl][2,2'-bipyridine]-4-carboxylic acid |
ChEMBL | CHEMBL2169917 |
DrugBank | |
ZINC | ZINC000095556198
|
PDB chain | 5ivc Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|