Structure of PDB 5iub Chain A Binding Site BS01 |
|
|
Ligand ID | 6DV |
InChI | InChI=1S/C20H21F2N9O/c21-13-3-4-15(14(22)12-13)30-9-7-29(8-10-30)6-5-24-19-26-18(23)31-20(27-19)25-17(28-31)16-2-1-11-32-16/h1-4,11-12H,5-10H2,(H3,23,24,25,26,27,28) |
InChIKey | NJQVZARFMYPNOT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Nc1nc(NCCN2CCN(CC2)c3ccc(F)cc3F)nc4nc(nn14)c5occc5 | OpenEye OEToolkits 2.0.4 | c1cc(oc1)c2nc3nc(nc(n3n2)N)NCCN4CCN(CC4)c5ccc(cc5F)F | ACDLabs 12.01 | C4N(CCN(CCNc3nc(N)n1c(nc(n1)c2ccco2)n3)C4)c5ccc(cc5F)F |
|
Formula | C20 H21 F2 N9 O |
Name | N~5~-{2-[4-(2,4-difluorophenyl)piperazin-1-yl]ethyl}-2-(furan-2-yl)[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
ChEMBL | CHEMBL184061 |
DrugBank | |
ZINC | ZINC000028382298
|
PDB chain | 5iub Chain A Residue 2401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|