Structure of PDB 5iu8 Chain A Binding Site BS01 |
|
|
Ligand ID | 6DZ |
InChI | InChI=1S/C15H21N9O/c1-22-6-8-23(9-7-22)5-4-17-14-19-13(16)24-15(20-14)18-12(21-24)11-3-2-10-25-11/h2-3,10H,4-9H2,1H3,(H3,16,17,18,19,20,21) |
InChIKey | NLHRMBTYEDTOKC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1CCN(CCNc2nc(N)n3nc(nc3n2)c4occc4)CC1 | ACDLabs 12.01 | n1c(nn3c1nc(NCCN2CCN(C)CC2)nc3N)c4ccco4 | OpenEye OEToolkits 2.0.4 | CN1CCN(CC1)CCNc2nc(n3c(n2)nc(n3)c4ccco4)N |
|
Formula | C15 H21 N9 O |
Name | 2-(furan-2-yl)-N~5~-[2-(4-methylpiperazin-1-yl)ethyl][1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
ChEMBL | CHEMBL3934661 |
DrugBank | |
ZINC | ZINC000584904751
|
PDB chain | 5iu8 Chain A Residue 2401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|