Structure of PDB 5isi Chain A Binding Site BS01 |
|
|
Ligand ID | 5N5 |
InChI | InChI=1S/C10H14N6O3/c11-1-4-6(17)7(18)10(19-4)16-3-15-5-8(12)13-2-14-9(5)16/h2-4,6-7,10,17-18H,1,11H2,(H2,12,13,14)/t4-,6-,7-,10-/m1/s1 |
InChIKey | GVSGUDGNTHCZHI-KQYNXXCUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | NC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2cnc3c(N)ncnc23 | OpenEye OEToolkits 1.7.6 | c1nc(c2c(n1)n(cn2)[C@H]3[C@@H]([C@@H]([C@H](O3)CN)O)O)N | ACDLabs 12.01 | n2c1c(ncnc1n(c2)C3OC(C(O)C3O)CN)N | OpenEye OEToolkits 1.7.6 | c1nc(c2c(n1)n(cn2)C3C(C(C(O3)CN)O)O)N | CACTVS 3.370 | NC[CH]1O[CH]([CH](O)[CH]1O)n2cnc3c(N)ncnc23 |
|
Formula | C10 H14 N6 O3 |
Name | 5'-amino-5'-deoxyadenosine |
ChEMBL | CHEMBL302376 |
DrugBank | |
ZINC | ZINC000003814316
|
PDB chain | 5isi Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|