Structure of PDB 5ipj Chain A Binding Site BS01 |
|
|
Ligand ID | 6CD |
InChI | InChI=1S/C20H23N5O2/c1-10-15-13(17(26)21-10)9-14(22-15)11-7-6-8-12-16(11)23-19(24-20(2,3)4)25(5)18(12)27/h6-10,22H,1-5H3,(H,21,26)(H,23,24)/t10-/m1/s1 |
InChIKey | HLPARXMUJBJYFM-SNVBAGLBSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | CC1c2c(cc([nH]2)c3cccc4c3N=C(N(C4=O)C)NC(C)(C)C)C(=O)N1 | CACTVS 3.385 | C[C@H]1NC(=O)c2cc([nH]c12)c3cccc4C(=O)N(C)C(=Nc34)NC(C)(C)C | ACDLabs 12.01 | CC1c4c(C(N1)=O)cc(c2cccc3C(=O)N(C)C(=Nc23)NC(C)(C)C)n4 | OpenEye OEToolkits 2.0.4 | C[C@@H]1c2c(cc([nH]2)c3cccc4c3N=C(N(C4=O)C)NC(C)(C)C)C(=O)N1 | CACTVS 3.385 | C[CH]1NC(=O)c2cc([nH]c12)c3cccc4C(=O)N(C)C(=Nc34)NC(C)(C)C |
|
Formula | C20 H23 N5 O2 |
Name | 2-(tert-butylamino)-3-methyl-8-[(6R)-6-methyl-4-oxo-1,4,5,6-tetrahydropyrrolo[3,4-b]pyrrol-2-yl]quinazolin-4(3H)-one |
ChEMBL | CHEMBL3979678 |
DrugBank | |
ZINC | ZINC000222218987
|
PDB chain | 5ipj Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|