Structure of PDB 5ie1 Chain A Binding Site BS01 |
|
|
Ligand ID | 6BS |
InChI | InChI=1S/C25H31N3O/c1-17-7-5-6-8-21(17)18-9-11-22-20(15-18)16-19(24(26)28-22)10-12-23(29)27-14-13-25(2,3)4/h5-9,11,15-16H,10,12-14H2,1-4H3,(H2,26,28)(H,27,29) |
InChIKey | XKCSLMBNFSFIEK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | CC(C)(C)CCNC(=O)CCc1cc2cc(ccc2nc1N)c3c(cccc3)C | CACTVS 3.385 | Cc1ccccc1c2ccc3nc(N)c(CCC(=O)NCCC(C)(C)C)cc3c2 | OpenEye OEToolkits 2.0.4 | Cc1ccccc1c2ccc3c(c2)cc(c(n3)N)CCC(=O)NCCC(C)(C)C |
|
Formula | C25 H31 N3 O |
Name | 3-[2-amino-6-(2-methylphenyl)quinolin-3-yl]-N-(3,3-dimethylbutyl)propanamide |
ChEMBL | CHEMBL3808672 |
DrugBank | |
ZINC | ZINC000112932842
|
PDB chain | 5ie1 Chain A Residue 407
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|