Structure of PDB 5idn Chain A Binding Site BS01 |
|
|
Ligand ID | 6A7 |
InChI | InChI=1S/C18H17ClN4O/c1-11-15-9-13(10-20-17(15)22-21-11)18(24)23-8-2-3-16(23)12-4-6-14(19)7-5-12/h4-7,9-10,16H,2-3,8H2,1H3,(H,20,21,22)/t16-/m0/s1 |
InChIKey | ODRITQGYYWHQGM-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1n[nH]c2ncc(cc12)C(=O)N3CCC[C@H]3c4ccc(Cl)cc4 | OpenEye OEToolkits 2.0.4 | Cc1c2cc(cnc2[nH]n1)C(=O)N3CCCC3c4ccc(cc4)Cl | OpenEye OEToolkits 2.0.4 | Cc1c2cc(cnc2[nH]n1)C(=O)N3CCC[C@H]3c4ccc(cc4)Cl | CACTVS 3.385 | Cc1n[nH]c2ncc(cc12)C(=O)N3CCC[CH]3c4ccc(Cl)cc4 | ACDLabs 12.01 | c1(Cl)ccc(cc1)C2N(CCC2)C(c4cc3c(C)nnc3nc4)=O |
|
Formula | C18 H17 Cl N4 O |
Name | [(2S)-2-(4-chlorophenyl)pyrrolidin-1-yl](3-methyl-1H-pyrazolo[3,4-b]pyridin-5-yl)methanone |
ChEMBL | CHEMBL3903492 |
DrugBank | |
ZINC |
|
PDB chain | 5idn Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|