Structure of PDB 5i83 Chain A Binding Site BS01 |
|
|
Ligand ID | 68Y |
InChI | InChI=1S/C18H20N2O2/c1-12-10-18(21)20-16-9-8-15(11-17(16)19-12)22-13(2)14-6-4-3-5-7-14/h3-9,11-13,19H,10H2,1-2H3,(H,20,21)/t12-,13-/m1/s1 |
InChIKey | ORPRVEZBBPKRRY-CHWSQXEVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | CC1CC(=O)Nc2ccc(cc2N1)OC(C)c3ccccc3 | CACTVS 3.385 | C[CH]1CC(=O)Nc2ccc(O[CH](C)c3ccccc3)cc2N1 | OpenEye OEToolkits 2.0.4 | C[C@@H]1CC(=O)Nc2ccc(cc2N1)O[C@H](C)c3ccccc3 | CACTVS 3.385 | C[C@@H]1CC(=O)Nc2ccc(O[C@H](C)c3ccccc3)cc2N1 | ACDLabs 12.01 | c2c1c(NC(CC(N1)C)=O)ccc2OC(C)c3ccccc3 |
|
Formula | C18 H20 N2 O2 |
Name | (4R)-4-methyl-7-[(1R)-1-phenylethoxy]-1,3,4,5-tetrahydro-2H-1,5-benzodiazepin-2-one |
ChEMBL | CHEMBL3814772 |
DrugBank | |
ZINC | ZINC000584904799
|
PDB chain | 5i83 Chain A Residue 1202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|