Structure of PDB 5i3v Chain A Binding Site BS01 |
|
|
Ligand ID | 68M |
InChI | InChI=1S/C25H32N4O/c1-16-7-6-11-27-22(16)18-8-9-21-19(14-18)15-20(23(26)29-21)13-17(2)24(30)28-12-10-25(3,4)5/h6-9,11,14-15,17H,10,12-13H2,1-5H3,(H2,26,29)(H,28,30)/t17-/m1/s1 |
InChIKey | ZVOWIRUWKAUSAB-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C@H](Cc1cc2cc(ccc2nc1N)c3ncccc3C)C(=O)NCCC(C)(C)C | ACDLabs 12.01 | CC(C)(C)CCNC(=O)C(C)Cc1cc2cc(ccc2nc1N)c3c(cccn3)C | OpenEye OEToolkits 2.0.4 | Cc1cccnc1c2ccc3c(c2)cc(c(n3)N)C[C@@H](C)C(=O)NCCC(C)(C)C | OpenEye OEToolkits 2.0.4 | Cc1cccnc1c2ccc3c(c2)cc(c(n3)N)CC(C)C(=O)NCCC(C)(C)C | CACTVS 3.385 | C[CH](Cc1cc2cc(ccc2nc1N)c3ncccc3C)C(=O)NCCC(C)(C)C |
|
Formula | C25 H32 N4 O |
Name | (2R)-3-[2-amino-6-(3-methylpyridin-2-yl)quinolin-3-yl]-N-(3,3-dimethylbutyl)-2-methylpropanamide |
ChEMBL | CHEMBL1821826 |
DrugBank | |
ZINC | ZINC000072179707
|
PDB chain | 5i3v Chain A Residue 404
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|