Structure of PDB 5hx8 Chain A Binding Site BS01 |
|
|
Ligand ID | 66P |
InChI | InChI=1S/C18H21N5O/c19-11-5-7-12(8-6-11)21-15-9-10-20-18(24)16(15)17-22-13-3-1-2-4-14(13)23-17/h1-4,9-12H,5-8,19H2,(H,22,23)(H2,20,21,24)/t11-,12+ |
InChIKey | JLWGOAGEDWMEBT-TXEJJXNPSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | N[C@H]1CC[C@H](CC1)NC2=C(C(=O)NC=C2)c3[nH]c4ccccc4n3 | ACDLabs 12.01 | C=1(C=CNC(=O)C=1c2nc3c(n2)cccc3)NC4CCC(CC4)N | OpenEye OEToolkits 2.0.4 | c1ccc2c(c1)[nH]c(n2)C3=C(C=CNC3=O)NC4CCC(CC4)N | CACTVS 3.385 | N[CH]1CC[CH](CC1)NC2=C(C(=O)NC=C2)c3[nH]c4ccccc4n3 |
|
Formula | C18 H21 N5 O |
Name | 4-[(4-aminocyclohexyl)amino]-3-(1H-benzimidazol-2-yl)-1H-pyridin-2-one; 4-[(cis-4-aminocyclohexyl)amino]-3-(1H-benzimidazol-2-yl)pyridin-2(1H)-one |
ChEMBL | CHEMBL3780091 |
DrugBank | |
ZINC |
|
PDB chain | 5hx8 Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|