Structure of PDB 5hu0 Chain A Binding Site BS01 |
|
|
Ligand ID | 66H |
InChI | InChI=1S/C21H18N4O3/c1-25-19(27)21(24-20(25)22,14-7-3-2-4-8-14)15-9-5-10-16(13-15)23-18(26)17-11-6-12-28-17/h2-13H,1H3,(H2,22,24)(H,23,26)/t21-/m1/s1 |
InChIKey | SOHROZVXKZYZIE-OAQYLSRUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1C(=N)N[C@](C1=O)(c2ccccc2)c3cccc(NC(=O)c4occc4)c3 | OpenEye OEToolkits 2.0.4 | [H]/N=C/1\N[C@](C(=O)N1C)(c2ccccc2)c3cccc(c3)NC(=O)c4ccco4 | OpenEye OEToolkits 2.0.4 | CN1C(=O)C(NC1=N)(c2ccccc2)c3cccc(c3)NC(=O)c4ccco4 | ACDLabs 12.01 | C1(NC(/N(C1=O)C)=N)(c3cc(NC(c2ccco2)=O)ccc3)c4ccccc4 | CACTVS 3.385 | CN1C(=N)N[C](C1=O)(c2ccccc2)c3cccc(NC(=O)c4occc4)c3 |
|
Formula | C21 H18 N4 O3 |
Name | N-{3-[(2E,4R)-2-imino-1-methyl-5-oxo-4-phenylimidazolidin-4-yl]phenyl}furan-2-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000200282302
|
PDB chain | 5hu0 Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|