Structure of PDB 5hes Chain A Binding Site BS01 |
|
|
Ligand ID | 032 |
InChI | InChI=1S/C23H18ClF2N3O3S/c1-2-9-33(31,32)29-19-8-7-18(25)20(21(19)26)22(30)17-12-28-23-16(17)10-14(11-27-23)13-3-5-15(24)6-4-13/h3-8,10-12,29H,2,9H2,1H3,(H,27,28) |
InChIKey | GPXBXXGIAQBQNI-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCC[S](=O)(=O)Nc1ccc(F)c(c1F)C(=O)c2c[nH]c3ncc(cc23)c4ccc(Cl)cc4 | OpenEye OEToolkits 1.7.0 | CCCS(=O)(=O)Nc1ccc(c(c1F)C(=O)c2c[nH]c3c2cc(cn3)c4ccc(cc4)Cl)F | ACDLabs 12.01 | O=S(=O)(Nc1ccc(F)c(c1F)C(=O)c3c2cc(cnc2nc3)c4ccc(Cl)cc4)CCC |
|
Formula | C23 H18 Cl F2 N3 O3 S |
Name | N-(3-{[5-(4-chlorophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]carbonyl}-2,4-difluorophenyl)propane-1-sulfonamide; Vemurafenib; PLX4032 |
ChEMBL | CHEMBL1229517 |
DrugBank | DB08881 |
ZINC | ZINC000052509366
|
PDB chain | 5hes Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|