Structure of PDB 5h8e Chain A Binding Site BS01 |
|
|
Ligand ID | 5Y3 |
InChI | InChI=1S/C21H25N9O/c1-13(31)25-17-9-16(5-6-18(17)29(2)8-7-22)26-19-10-20(27-15-3-4-15)30-21(28-19)14(11-23)12-24-30/h5-6,9-10,12,15,27H,3-4,7-8,22H2,1-2H3,(H,25,31)(H,26,28) |
InChIKey | FBMJGDCKBKUMJF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN(CCN)c1ccc(Nc2cc(NC3CC3)n4ncc(C#N)c4n2)cc1NC(C)=O | OpenEye OEToolkits 2.0.4 | CC(=O)Nc1cc(ccc1N(C)CCN)Nc2cc(n3c(n2)c(cn3)C#N)NC4CC4 |
|
Formula | C21 H25 N9 O |
Name | ~{N}-[2-[2-azanylethyl(methyl)amino]-5-[[3-cyano-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-5-yl]amino]phenyl]ethanamide |
ChEMBL | CHEMBL3103192 |
DrugBank | |
ZINC | ZINC000103228961
|
PDB chain | 5h8e Chain A Residue 421
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|