Structure of PDB 5h13 Chain A Binding Site BS01 |
|
|
Ligand ID | LQA |
InChI | InChI=1S/C25H23N3O4/c1-14(2)32-21-5-4-15(8-22(21)29-3)17-10-20-18-11-24-23(30-13-31-24)9-16(18)6-7-28(20)25(27)19(17)12-26/h4-5,8-11,14,27H,6-7,13H2,1-3H3/b27-25- |
InChIKey | LVLOUZWLCDLTGX-RFBIWTDZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cc(ccc1OC(C)C)C2=C(C#N)C(=N)N3CCc4cc5OCOc5cc4C3=C2 | OpenEye OEToolkits 2.0.6 | [H]/N=C\1/C(=C(C=C2N1CCc3c2cc4c(c3)OCO4)c5ccc(c(c5)OC)OC(C)C)C#N | OpenEye OEToolkits 2.0.6 | CC(C)Oc1ccc(cc1OC)C2=C(C(=N)N3CCc4cc5c(cc4C3=C2)OCO5)C#N |
|
Formula | C25 H23 N3 O4 |
Name | 4-azanylidene-2-(3-methoxy-4-propan-2-yloxy-phenyl)-6,7-dihydro-[1,3]benzodioxolo[6,5-a]quinolizine-3-carbonitrile |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5h13 Chain A Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|